4-CHLORO-2,6-DIPHENYLPYRIMIDINE structure
|
Common Name | 4-CHLORO-2,6-DIPHENYLPYRIMIDINE | ||
|---|---|---|---|---|
| CAS Number | 29509-91-9 | Molecular Weight | 266.725 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 339.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H11ClN2 | Melting Point | 104-105℃ | |
| MSDS | N/A | Flash Point | 189.4±11.5 °C | |
| Name | 4-chloro-2,6-diphenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.2±35.0 °C at 760 mmHg |
| Melting Point | 104-105℃ |
| Molecular Formula | C16H11ClN2 |
| Molecular Weight | 266.725 |
| Flash Point | 189.4±11.5 °C |
| Exact Mass | 266.061066 |
| PSA | 25.78000 |
| LogP | 4.89 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | MJDDVTZXYXHTRY-UHFFFAOYSA-N |
| SMILES | Clc1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
|
~83%
4-CHLORO-2,6-DI... CAS#:29509-91-9 |
| Literature: Brown; Cowden; Lan; Mori Australian Journal of Chemistry, 1984 , vol. 37, # 1 p. 155 - 163 |
|
~%
4-CHLORO-2,6-DI... CAS#:29509-91-9 |
| Literature: Brown; Cowden; Lan; Mori Australian Journal of Chemistry, 1984 , vol. 37, # 1 p. 155 - 163 |
|
~%
4-CHLORO-2,6-DI... CAS#:29509-91-9 |
| Literature: Brown; Cowden; Lan; Mori Australian Journal of Chemistry, 1984 , vol. 37, # 1 p. 155 - 163 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-2,4-diphenylpyrimidin |
| 2,6-Diphenyl-4-chlorpyrimidin |
| 4-Chlor-2,6-diphenyl-pyrimidin |
| 4-CHLORO-2,6-DIPHENYLPYRIMIDINE |
| 4-Chloro-2,6-diphenylpyrimidin |
| Pyrimidine, 4-chloro-2,6-diphenyl- |
| Pyrimidine,4-chloro-2,6-diphenyl |
| 4-chloro-2,6-diphenyl-pyrimidine |