4-[(4-methylaminophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one
Modify Date: 2024-07-18 09:52:04
![4-[(4-methylaminophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one Structure](https://image.chemsrc.com/caspic/461/2946-98-7.png)
4-[(4-methylaminophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-[(4-methylaminophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 2946-98-7 | Molecular Weight | 227.26200 | |
| Density | 1.16g/cm3 | Boiling Point | 391.1ºC at 760mmHg | |
| Molecular Formula | C13H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 4-[[4-(methylamino)phenyl]hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 391.1ºC at 760mmHg |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26200 |
| Flash Point | 190.3ºC |
| Exact Mass | 227.10600 |
| PSA | 53.49000 |
| LogP | 2.33730 |
| Vapour Pressure | 2.52E-06mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | OKWVLSBVFUAJHV-UHFFFAOYSA-N |
| SMILES | CNc1ccc(N=Nc2ccc(O)cc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
4-[(4-methylami... CAS#:2946-98-7 |
| Literature: Miller; Miller Journal of Experimental Medicine, 1948 , vol. 87, p. 139,141 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4'-Hydroxy-N-methyl-4-aminoazobenzol |
| N-Methyl-4-amino-4'-hydroxyazobenzene |
| 4-Monomethylamino-4'-hydroxy-azobenzol |
| 4'-Hydroxy-4-methylamino-azobenzol |
| 4'-Methylamino-4-hydroxy-azobenzol |