2H-1,4-Benzodiazepin-2-one,1,3-dihydro-1-(methoxymethyl)-7-nitro-5-phenyl-
Modify Date: 2025-08-25 16:50:36
2H-1,4-Benzodiazepin-2-one,1,3-dihydro-1-(methoxymethyl)-7-nitro-5-phenyl- structure
|
Common Name | 2H-1,4-Benzodiazepin-2-one,1,3-dihydro-1-(methoxymethyl)-7-nitro-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 29442-58-8 | Molecular Weight | 325.31900 | |
| Density | 1.33g/cm3 | Boiling Point | 556.2ºC at 760mmHg | |
| Molecular Formula | C17H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | 1-(methoxymethyl)-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 556.2ºC at 760mmHg |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.31900 |
| Flash Point | 290.2ºC |
| Exact Mass | 325.10600 |
| PSA | 87.72000 |
| LogP | 2.40650 |
| Vapour Pressure | 2.08E-12mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | CWCAUFWLFIUQHP-UHFFFAOYSA-N |
| SMILES | COCN1C(=O)CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
2H-1,4-Benzodia... CAS#:29442-58-8 |
| Literature: Kishimoto; Matsuo; Ueda Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1477 - 1480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-36YG4ZMR69 |
| Motrazepam |
| 1,3-dihydro-1-methoxymethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one |
| Motrazepamum |