1,5-bis(4-methoxyanilino)anthracene-9,10-dione structure
|
Common Name | 1,5-bis(4-methoxyanilino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 2944-16-3 | Molecular Weight | 450.48500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis(4-methoxyanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H22N2O4 |
|---|---|
| Molecular Weight | 450.48500 |
| Exact Mass | 450.15800 |
| PSA | 76.66000 |
| LogP | 6.11240 |
| InChIKey | ATQNDVLUWRUMEA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cccc3c2C(=O)c2cccc(Nc4ccc(OC)cc4)c2C3=O)cc1 |
|
~%
1,5-bis(4-metho... CAS#:2944-16-3 |
| Literature: Cook; Waddington Journal of the Chemical Society, 1945 , p. 402,404 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,5-di-p-anisidino-anthraquinone |
| 1,5-Di-p-anisidino-anthrachinon |