Benzoic acid, anhydride with N-(1,2-dichloro-1-propen-1-yl)benzenecarboximidic acid structure
|
Common Name | Benzoic acid, anhydride with N-(1,2-dichloro-1-propen-1-yl)benzenecarboximidic acid | ||
|---|---|---|---|---|
| CAS Number | 29431-46-7 | Molecular Weight | 334.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzoic acid, anhydride with N-(1,2-dichloro-1-propen-1-yl)benzenecarboximidic acid |
|---|
| Molecular Formula | C17H13Cl2NO2 |
|---|---|
| Molecular Weight | 334.2 |
| InChIKey | XOCIYGQVQFTMIL-UHFFFAOYSA-N |
| SMILES | CC(Cl)=C(Cl)N=C(OC(=O)c1ccccc1)c1ccccc1 |