BN-104
Modify Date: 2025-08-26 19:02:21
BN-104 structure
|
Common Name | BN-104 | ||
|---|---|---|---|---|
| CAS Number | 2938995-50-5 | Molecular Weight | 570.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35FN8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BN-104Menin-MLL inhibitor 27 can inhibit the Menin-MLL interaction and can be used in cancer research, such as acute myeloid leukemia[1]. |
| Name | BN-104 |
|---|
| Description | Menin-MLL inhibitor 27 can inhibit the Menin-MLL interaction and can be used in cancer research, such as acute myeloid leukemia[1]. |
|---|---|
| Related Catalog | |
| Target |
Menin-MLL |
| Molecular Formula | C31H35FN8O2 |
|---|---|
| Molecular Weight | 570.66 |
| InChIKey | XDXAYPYOHXUEAM-CLHVYKLBSA-N |
| SMILES | O=C(C1NCC2CCCC21)N1CCC2(CC1)CN(c1ncnnc1Oc1ccc(F)cc1-c1cncnc1C1CC1)C2 |