ACBI3
Modify Date: 2025-08-25 19:18:03
ACBI3 structure
|
Common Name | ACBI3 | ||
|---|---|---|---|---|
| CAS Number | 2938169-76-5 | Molecular Weight | 1019.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H62N14O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ACBI3ACBI3 (compound 7) is a pan-KRAS degrader. ACBI3 achieves in vivo degradation of oncogenic KRAS[1]. |
| Name | ACBI3 |
|---|
| Description | ACBI3 (compound 7) is a pan-KRAS degrader. ACBI3 achieves in vivo degradation of oncogenic KRAS[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C50H62N14O6S2 |
|---|---|
| Molecular Weight | 1019.25 |
| InChIKey | DQRZNYPHOWVXPQ-YDUPODKQSA-N |
| SMILES | Cc1ncsc1-c1ccc(C(CO)NC(=O)C2CC(O)CN2C(=O)C(C(C)C)n2cc(OCCCCN3CCCN(c4nccc(-c5noc(C6(C)CCCc7sc(N)c(C#N)c76)n5)n4)C(C)C3)nn2)cc1 |