Bis(isopropyloxy)[[2,6-bis(1,1-dimethylethyl)-4-methylphenyl]oxy]borane structure
|
Common Name | Bis(isopropyloxy)[[2,6-bis(1,1-dimethylethyl)-4-methylphenyl]oxy]borane | ||
|---|---|---|---|---|
| CAS Number | 2929-87-5 | Molecular Weight | 348.32800 | |
| Density | 0.914g/cm3 | Boiling Point | 354.5ºC at 760mmHg | |
| Molecular Formula | C21H37BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.7ºC | |
| Name | (2,6-ditert-butyl-4-methylphenyl) dipropan-2-yl borate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.914g/cm3 |
|---|---|
| Boiling Point | 354.5ºC at 760mmHg |
| Molecular Formula | C21H37BO3 |
| Molecular Weight | 348.32800 |
| Flash Point | 118.7ºC |
| Exact Mass | 348.28400 |
| PSA | 27.69000 |
| LogP | 5.80370 |
| Vapour Pressure | 6.8E-05mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | DUVZAERRPMFJPA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)c(OB(OC(C)C)OC(C)C)c(C(C)(C)C)c1 |
| HS Code | 2920909090 |
|---|
|
~%
Bis(isopropylox... CAS#:2929-87-5 |
| Literature: Washburn et al. Advances in Chemistry Series, 1959 , # 23 p. 129,139 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,6-Di-tert-butyl-4-methylphenyl diisopropyl borate |
| 2,6-Di-t-butyl-p-kresyl-diisopropylborat |
| 2,6-di-tert-butyl-4-methylphenyl dipropan-2-yl borate |
| 2,6-Di-tert.-butyl-4-methyl-phenyl-diisopropylborat |