1,2-DIIODO-4,5-DINITRO-BENZENE structure
|
Common Name | 1,2-DIIODO-4,5-DINITRO-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 29270-47-1 | Molecular Weight | 419.90000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2I2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-diiodo-4,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H2I2N2O4 |
|---|---|
| Molecular Weight | 419.90000 |
| Exact Mass | 419.81000 |
| PSA | 91.64000 |
| LogP | 3.75860 |
| InChIKey | KAQQACPCRNDISO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(I)c(I)cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~40%
1,2-DIIODO-4,5-... CAS#:29270-47-1 |
| Literature: Zimcik, Petr; Miletin, Miroslav; Radilova, Hana; Novakova, Veronika; Kopecky, Kamil; Svec, Jaroslav; Rudolf, Emil Photochemistry and Photobiology, 2010 , vol. 86, # 1 p. 168 - 175 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-dinitro-4,5-di-iodobenzene |
| 1,2-Diiodo-4,5-dinitrobenzol |
| Benzene,1,2-diiodo-4,5-dinitro |
| 1,2-diiodo-4,5-dinitro-benzene |
| 4.5-Dijod-1.2-dinitrobenzol |