[5-(2,4-Dichlorophenyl)-2-furyl]methanol structure
|
Common Name | [5-(2,4-Dichlorophenyl)-2-furyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 292644-30-5 | Molecular Weight | 243.08600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(2,4-Dichlorophenyl)-2-furyl]methanol |
|---|
| Molecular Formula | C11H8Cl2O2 |
|---|---|
| Molecular Weight | 243.08600 |
| Exact Mass | 241.99000 |
| PSA | 33.37000 |
| LogP | 3.74570 |
| InChIKey | GTXVKLIDWYHAAS-UHFFFAOYSA-N |
| SMILES | OCc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| HS Code | 2932190090 |
|---|
|
~59%
[5-(2,4-Dichlor... CAS#:292644-30-5 |
| Literature: Redondo, Miriam; Brea, Jose; Perez, Daniel I.; Soteras, Ignacio; Val, Cristina; Perez, Concepcion; Morales-Garcia, Jose A.; Alonso-Gil, Sandra; Paul-Fernandez, Nuria; Martin-Alvarez, Rocio; Cadavid, Maria Isabel; Loza, Maria Isabel; Perez-Castillo, Ana; Mengod, Guadalupe; Campillo, Nuria E.; Martinez, Ana; Gil, Carmen Journal of Medicinal Chemistry, 2012 , vol. 55, # 7 p. 3274 - 3284 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |