dipyrromethane cofactor structure
|
Common Name | dipyrromethane cofactor | ||
|---|---|---|---|---|
| CAS Number | 29261-13-0 | Molecular Weight | 435.42800 | |
| Density | 1.51g/cm3 | Boiling Point | 744.6ºC at 760mmHg | |
| Molecular Formula | C20H25N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 404.1ºC | |
| Name | 3-[5-[[5-(aminomethyl)-3-(2-carboxyethyl)-4-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 744.6ºC at 760mmHg |
| Molecular Formula | C20H25N3O8 |
| Molecular Weight | 435.42800 |
| Flash Point | 404.1ºC |
| Exact Mass | 435.16400 |
| PSA | 206.80000 |
| LogP | 1.38120 |
| Vapour Pressure | 2.78E-23mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | VBVFYFROBGFPFB-UHFFFAOYSA-N |
| SMILES | NCc1[nH]c(Cc2[nH]cc(CCC(=O)O)c2CC(=O)O)c(CCC(=O)O)c1CC(=O)O |
|
~%
dipyrromethane ... CAS#:29261-13-0 |
| Literature: Neidhart, Werner L.; Anderson, Paul C.; Hart, Graham J.; Battersby, Alan R. Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 19 p. 2677 - 2689 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pyrromethane cofactor |