4-[2-(Dimethylamino)ethoxy(2-methylphenyl)methyl]phenol
Modify Date: 2025-08-26 08:03:26
![4-[2-(Dimethylamino)ethoxy(2-methylphenyl)methyl]phenol Structure](https://image.chemsrc.com/caspic/485/29214-97-9.png)
4-[2-(Dimethylamino)ethoxy(2-methylphenyl)methyl]phenol structure
|
Common Name | 4-[2-(Dimethylamino)ethoxy(2-methylphenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 29214-97-9 | Molecular Weight | 285.38100 | |
| Density | 1.081g/cm3 | Boiling Point | 407.4ºC at 760mmHg | |
| Molecular Formula | C18H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | 4-[2-(dimethylamino)ethoxy-(2-methylphenyl)methyl]phenol |
|---|
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 407.4ºC at 760mmHg |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.38100 |
| Flash Point | 200.2ºC |
| Exact Mass | 285.17300 |
| PSA | 32.70000 |
| LogP | 3.36820 |
| Vapour Pressure | 3.22E-07mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | HKMMNJKPPYCQOH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(OCCN(C)C)c1ccc(O)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
4-[2-(Dimethyla... CAS#:29214-97-9 |
| Literature: den Besten; Mulder; Funcke; Nauta Arzneimittel-Forschung, 1970 , vol. 20, # 4 p. 538 - 542 |
|
~%
4-[2-(Dimethyla... CAS#:29214-97-9 |
| Literature: den Besten; Mulder; Funcke; Nauta Arzneimittel-Forschung, 1970 , vol. 20, # 4 p. 538 - 542 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |