Diethyl 2-(p-tolyl)malonate structure
|
Common Name | Diethyl 2-(p-tolyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 29148-27-4 | Molecular Weight | 250.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 321.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 151.8±22.1 °C | |
| Name | diethyl 2-(4-methylphenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.2±27.0 °C at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.290 |
| Flash Point | 151.8±22.1 °C |
| Exact Mass | 250.120514 |
| PSA | 52.60000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | WGBSHZUHSDGHLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc(C)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Propanedioic acid, 2-(4-methylphenyl)-, diethyl ester |
| Diethyl (4-methylphenyl)malonate |
| diethyl p-tolylmalonate |
| MFCD00013242 |
| Diethyl 2-(p-tolyl)malonate |