4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid,ethyl 2-piperazin-1-ylacetate
Modify Date: 2025-12-02 13:53:06
4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid,ethyl 2-piperazin-1-ylacetate structure
|
Common Name | 4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid,ethyl 2-piperazin-1-ylacetate | ||
|---|---|---|---|---|
| CAS Number | 29140-80-5 | Molecular Weight | 420.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H32N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid,ethyl 2-piperazin-1-ylacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H32N4O4S2 |
|---|---|
| Molecular Weight | 420.59000 |
| Exact Mass | 420.18600 |
| PSA | 145.24000 |
| Vapour Pressure | 0.000168mmHg at 25°C |
| InChIKey | DADXTLAWWNOUPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCN(C(=S)S)CC1.CCOC(=O)CN1CCNCC1 |
| 4-(Dithiocarboxy)-1-piperazineacetic acid 1-ethyl ester compd. with ethyl 1-piperazineacetate |
| 1-Piperazineacetic acid,4-(dithiocarboxy)-,1-ethyl ester,compd. with ethyl 1-piperazineacetate (1:1) |
| 4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid-ethyl piperazin-1-ylacetate (1:1) |
| 4-(2-ethoxy-2-oxoethyl)piperazine-1-carbodithioic acid |