N-[3-(dibenzylamino)phenyl]acetamide structure
|
Common Name | N-[3-(dibenzylamino)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 29103-60-4 | Molecular Weight | 330.42300 | |
| Density | 1.172g/cm3 | Boiling Point | 571ºC at 760mmHg | |
| Molecular Formula | C22H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.1ºC | |
| Name | N-[3-(dibenzylamino)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 571ºC at 760mmHg |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.42300 |
| Flash Point | 299.1ºC |
| Exact Mass | 330.17300 |
| PSA | 35.83000 |
| LogP | 5.50130 |
| Vapour Pressure | 4.78E-13mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | HQLFTQUBRWAEGR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(N(Cc2ccccc2)Cc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[3-(dibenzyla... CAS#:29103-60-4 |
| Literature: Xiao, Qing; Tian, Leiming; Tan, Renchang; Xia, Ying; Qiu, Di; Zhang, Yan; Wang, Jianbo Organic Letters, 2012 , vol. 14, # 16 p. 4230 - 4233 |
|
~%
N-[3-(dibenzyla... CAS#:29103-60-4 |
| Literature: Bayer and Co. Patent: DE81374 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 204 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 249-438-6 |
| N'.N'-Dibenzyl-N-acetyl-m-phenylendiamin |
| 3-Acetamido-N,N-dibenzylanilin |