7-hydroxy-3-(2,4,5-trimethoxyphenyl)chromen-4-one structure
|
Common Name | 7-hydroxy-3-(2,4,5-trimethoxyphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 29096-94-4 | Molecular Weight | 328.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-hydroxy-3-(2,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16O6 |
|---|---|
| Molecular Weight | 328.31600 |
| Exact Mass | 328.09500 |
| PSA | 78.13000 |
| LogP | 3.19140 |
| InChIKey | IXZYJZHCXHSCDY-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(-c2coc3cc(O)ccc3c2=O)cc1OC |
|
~%
7-hydroxy-3-(2,... CAS#:29096-94-4 |
| Literature: Bioscience, Biotechnology, and Biochemistry, , vol. 57, # 1 p. 107 - 114 |
|
~%
7-hydroxy-3-(2,... CAS#:29096-94-4 |
| Literature: Bioscience, Biotechnology, and Biochemistry, , vol. 57, # 1 p. 107 - 114 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| CPD-9532 |
| 7-Hydroxy-2',4',5'-trimethoxyisoflavone |