2-Amino-2-deoxy-D-glucose sulfate (1:1) structure
|
Common Name | 2-Amino-2-deoxy-D-glucose sulfate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 29031-19-4 | Molecular Weight | 277.250 | |
| Density | 1.563g/cm3 | Boiling Point | 449.9ºC at 760mmHg | |
| Molecular Formula | C6H13NO5.xH2O4S | Melting Point | 176°C | |
| MSDS | N/A | Flash Point | 225.9ºC | |
Use of 2-Amino-2-deoxy-D-glucose sulfate (1:1)Glucosamine sulfate (D-Glucosamine sulfate) is an amino sugar and a prominent precursor in the biochemical synthesis of glycosylated proteins and lipids, is used as a dietary supplement. Glucosamine sulfate also is a natural constituent of glycosaminoglycans in the cartilage matrix and synovial fluid, which when administered exogenously, exerts pharmacological effects on osteoarthritic cartilage and chondrocytes[1]. |
| Name | D-Glucosamine Sulfate Salt |
|---|---|
| Synonym | More Synonyms |
| Description | Glucosamine sulfate (D-Glucosamine sulfate) is an amino sugar and a prominent precursor in the biochemical synthesis of glycosylated proteins and lipids, is used as a dietary supplement. Glucosamine sulfate also is a natural constituent of glycosaminoglycans in the cartilage matrix and synovial fluid, which when administered exogenously, exerts pharmacological effects on osteoarthritic cartilage and chondrocytes[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Glucosamine sulfate (D-Glucosamine sulfate) exhibits dose-dependent DPPH antioxidant activity[2]. Glucosamine sulfate treatment of Short-term (4 h) inhibits HIF-1α at the protein level, decreases phosphorylation of p70S6K and S6, translation-related proteins[3]. Glucosamine sulfate significantly decreases renal expression of α-smooth muscle actin, collagen I, and fibronectin in the obstructed kidneys and TGF-β1-treated renal cells[4]. |
| References |
| Density | 1.563g/cm3 |
|---|---|
| Boiling Point | 449.9ºC at 760mmHg |
| Melting Point | 176°C |
| Molecular Formula | C6H13NO5.xH2O4S |
| Molecular Weight | 277.250 |
| Flash Point | 225.9ºC |
| Exact Mass | 277.046753 |
| PSA | 206.99000 |
| Vapour Pressure | 5.53E-10mmHg at 25°C |
| InChIKey | FGNPLIQZJCYWLE-BTVCFUMJSA-L |
| SMILES | NC(C=O)C(O)C(O)C(O)CO.O=S(=O)([O-])[O-] |
| Storage condition | -20?C Freezer |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| RTECS | AU7417000 |
| HS Code | 2932999099 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D-Glucose, 2-amino-2-deoxy-, sulfate (1:1) |
| D-Glucosamine sulfate |
| 2-Amino-2-deoxy-D-glucose sulfate (1:1) |
| EINECS 249-379-6 |
| MFCD00151175 |