2(5H)-Furanone,5-[(4-hydroxy-1-naphthalenyl)imino]- structure
|
Common Name | 2(5H)-Furanone,5-[(4-hydroxy-1-naphthalenyl)imino]- | ||
|---|---|---|---|---|
| CAS Number | 29028-90-8 | Molecular Weight | 239.22600 | |
| Density | 1.34g/cm3 | Boiling Point | 466.2ºC at 760mmHg | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 5-(4-hydroxynaphthalen-1-yl)iminofuran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760mmHg |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.22600 |
| Flash Point | 235.8ºC |
| Exact Mass | 239.05800 |
| PSA | 58.89000 |
| LogP | 2.68840 |
| Vapour Pressure | 2.58E-09mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | NFUYVPQFLBKRAA-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=Nc2ccc(O)o2)c2ccccc21 |
|
~%
2(5H)-Furanone,... CAS#:29028-90-8 |
| Literature: Tsou et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 4613,4616 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| furan-2,5-dione-mono-(4-hydroxy-[1]naphthylimine) |
| Furan-2,5-dion-mono-(4-hydroxy-[1]naphthylimin) |