3-(2,3-Dimethoxyphenyl)-2-methylpropenoic acid 7-nitro-8-quinolyl ester structure
|
Common Name | 3-(2,3-Dimethoxyphenyl)-2-methylpropenoic acid 7-nitro-8-quinolyl ester | ||
|---|---|---|---|---|
| CAS Number | 29002-40-2 | Molecular Weight | 394.37700 | |
| Density | 1.317g/cm3 | Boiling Point | 590ºC at 760mmHg | |
| Molecular Formula | C21H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.6ºC | |
| Name | (7-nitroquinolin-8-yl) (E)-3-(2,3-dimethoxyphenyl)-2-methylprop-2-enoate |
|---|
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 590ºC at 760mmHg |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.37700 |
| Flash Point | 310.6ºC |
| Exact Mass | 394.11600 |
| PSA | 103.47000 |
| LogP | 4.69230 |
| Vapour Pressure | 6.78E-14mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | KURSJOHAXXDKQL-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=C(C)C(=O)Oc2c([N+](=O)[O-])ccc3cccnc23)c1OC |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |