2-(4-Methoxybenzylidene)propanoic acid 7-nitro-8-quinolyl ester structure
|
Common Name | 2-(4-Methoxybenzylidene)propanoic acid 7-nitro-8-quinolyl ester | ||
|---|---|---|---|---|
| CAS Number | 29002-39-9 | Molecular Weight | 364.35100 | |
| Density | 1.322g/cm3 | Boiling Point | 585.5ºC at 760 mmHg | |
| Molecular Formula | C20H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.9ºC | |
| Name | (7-nitroquinolin-8-yl) (E)-3-(4-methoxyphenyl)-2-methylprop-2-enoate |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 585.5ºC at 760 mmHg |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.35100 |
| Flash Point | 307.9ºC |
| Exact Mass | 364.10600 |
| PSA | 94.24000 |
| LogP | 4.68370 |
| Vapour Pressure | 1.08E-13mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | VXZCUKLJHIFYOH-OUKQBFOZSA-N |
| SMILES | COc1ccc(C=C(C)C(=O)Oc2c([N+](=O)[O-])ccc3cccnc23)cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |