5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indole-3-carbaldehyde
Modify Date: 2025-10-24 11:33:55
5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indole-3-carbaldehyde structure
|
Common Name | 5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 28837-84-5 | Molecular Weight | 301.34000 | |
| Density | 1.289g/cm3 | Boiling Point | 549.5ºC at 760mmHg | |
| Molecular Formula | C16H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.1ºC | |
| Name | 5-methoxy-2-(4-methylpiperazine-1-carbonyl)-1H-indole-3-carbaldehyde |
|---|
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 549.5ºC at 760mmHg |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.34000 |
| Flash Point | 286.1ºC |
| Exact Mass | 301.14300 |
| PSA | 65.64000 |
| LogP | 1.25240 |
| Vapour Pressure | 4E-12mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | KOLWXIIJKVLBMG-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C(=O)N3CCN(C)CC3)c(C=O)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |