tert-Butyl 4-(4-amino-2-cyanophenyl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(4-amino-2-cyanophenyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 288251-85-4 | Molecular Weight | 302.371 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 510.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.4±30.1 °C | |
| Name | tert-butyl 4-(4-amino-2-cyanophenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.3±50.0 °C at 760 mmHg |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.371 |
| Flash Point | 262.4±30.1 °C |
| Exact Mass | 302.174286 |
| PSA | 82.59000 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | MATLRBKMCBPXPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N)cc2C#N)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
tert-Butyl 4-(4... CAS#:288251-85-4 |
| Literature: F. HOFFMANN-LA ROCHE AG Patent: WO2008/141976 A1, 2008 ; Location in patent: Page/Page column 63; 64 ; WO 2008/141976 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinecarboxylic acid, 4-(4-amino-2-cyanophenyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 4-(4-amino-2-cyanophenyl)-1-piperazinecarboxylate |