4(1H)-Pyrimidinone,6-cyclohexyl-2,3-dihydro-2-thioxo- structure
|
Common Name | 4(1H)-Pyrimidinone,6-cyclohexyl-2,3-dihydro-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 28811-81-6 | Molecular Weight | 210.29600 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-cyclohexyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.29600 |
| Exact Mass | 210.08300 |
| PSA | 80.74000 |
| LogP | 2.48020 |
| Index of Refraction | 1.612 |
| InChIKey | RONPYGBTCPNBSA-UHFFFAOYSA-N |
| SMILES | O=c1cc(C2CCCCC2)[nH]c(=S)[nH]1 |
|
~%
4(1H)-Pyrimidin... CAS#:28811-81-6 |
| Literature: Anderson et al. Journal of the American Chemical Society, 1945 , vol. 67, p. 2197,2200 |
| 6-Cyclohexyl-2-thiouracil |
| 6-cyclohexyl-2-thioxo-2,3-dihydro-1H-pyrimidin-4-one |