succinic acid, compound with 2-pyridinoethyl 3-methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate (1:1) structure
|
Common Name | succinic acid, compound with 2-pyridinoethyl 3-methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 28782-19-6 | Molecular Weight | 509.54800 | |
| Density | N/A | Boiling Point | 564.1ºC at 760 mmHg | |
| Molecular Formula | C28H31NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.9ºC | |
| Name | butanedioic acid,2-piperidin-1-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 564.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C28H31NO8 |
| Molecular Weight | 509.54800 |
| Flash Point | 294.9ºC |
| Exact Mass | 509.20500 |
| PSA | 134.35000 |
| LogP | 4.28480 |
| Vapour Pressure | 9.56E-13mmHg at 25°C |
| InChIKey | JBTZPEVGOCVUJT-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cccc2c1=O.O=C(O)CCC(=O)O |
| EINECS 249-217-4 |
| Flavoxate succinate |
| UNII-147P9DP7TC |