2-Propen-1-one,1-(2-hydroxyphenyl)-3-(3-pyridinyl)-
Modify Date: 2025-08-26 18:48:04
2-Propen-1-one,1-(2-hydroxyphenyl)-3-(3-pyridinyl)- structure
|
Common Name | 2-Propen-1-one,1-(2-hydroxyphenyl)-3-(3-pyridinyl)- | ||
|---|---|---|---|---|
| CAS Number | 2875-25-4 | Molecular Weight | 225.24300 | |
| Density | 1.241g/cm3 | Boiling Point | 414.3ºC at 760mmHg | |
| Molecular Formula | C14H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxyphenyl)-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760mmHg |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24300 |
| Exact Mass | 225.07900 |
| PSA | 50.19000 |
| LogP | 2.68330 |
| Vapour Pressure | 1.87E-07mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | CRWNZUBUBIULHB-BQYQJAHWSA-N |
| SMILES | O=C(C=Cc1cccnc1)c1ccccc1O |
| HS Code | 2933399090 |
|---|
|
~%
2-Propen-1-one,... CAS#:2875-25-4 |
| Literature: Chandrasekhar; Vijeender; Venkatram Reddy Tetrahedron Letters, 2005 , vol. 46, # 41 p. 6991 - 6993 |
|
~%
2-Propen-1-one,... CAS#:2875-25-4 |
| Literature: Yang, Guangfu; Jiang, Xiaohua; Yang, Huazheng Pest Management Science, 2002 , vol. 58, # 10 p. 1063 - 1067 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-hydroxy-phenyl)-3-pyridin-3-yl-propenone |
| 1-(2-Hydroxy-phenyl)-3-<pyridyl-(3)>-propen-(2)-on-(1) |
| 1-<Pyridyl-(3)>-2-(2-hydroxy-benzoyl)-ethylen |
| 1-(2-hydroxyphenyl)-3-(3-pyridyl)prop-2-en-1-one |
| 3-oxo-1-(pyrid-3-yl)-3-(2'-hydroxyphenyl)-propene |