1,4,5,6-tetrahydro-3-phenylcyclopentapyrazole structure
|
Common Name | 1,4,5,6-tetrahydro-3-phenylcyclopentapyrazole | ||
|---|---|---|---|---|
| CAS Number | 28749-00-0 | Molecular Weight | 184.23700 | |
| Density | 1.185g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C12H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | 3-phenyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.23700 |
| Flash Point | 198.4ºC |
| Exact Mass | 184.10000 |
| PSA | 28.68000 |
| LogP | 2.56540 |
| Vapour Pressure | 1.17E-06mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | VHFKRPJDQQZAOP-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2n[nH]c3c2CCC3)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Phenyl-1.4.5.6-tetrahydro-cyclopentapyrazol |
| 3-Phenyl-4.5-trimethylen-pyrazol |
| 1,4,5,6-Tetrahydro-3-phenylcyclopentapyrazole |
| 3-phenyl-4,5-cyclopentenopyrazole |
| 3-Phenyl-1,4,5,6-tetrahydropentapyrazol |