3-Fluoro-2-(trifluoromethyl)benzamide structure
|
Common Name | 3-Fluoro-2-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 287398-80-5 | Molecular Weight | 207.12500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5F4NO |
|---|---|
| Molecular Weight | 207.12500 |
| Exact Mass | 207.03100 |
| PSA | 43.09000 |
| LogP | 2.64370 |
| InChIKey | JEHSVMLIHCECTD-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc(F)c1C(F)(F)F |
| HS Code | 2924299090 |
|---|
|
~%
3-Fluoro-2-(tri... CAS#:287398-80-5 |
| Literature: Nelson, Derek W.; Gregg, Robert J.; Kort, Michael E.; Perez-Medrano, Arturo; Voight, Eric A.; Wang, Ying; Grayson, George; Namovic, Marian T.; Donnelly-Roberts, Diana L.; Niforatos, Wende; Honore, Prisca; Jarvis, Michael F.; Faltynek, Connie R.; Carroll, William A. Journal of Medicinal Chemistry, 2006 , vol. 49, # 12 p. 3659 - 3666 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-fluoro-2-trifluoromethylbenzamide |
| JRD-1212 |
| PC0386 |