2,3,5,6-tetraiodobenzene-1,4-dicarbonyl chloride
Modify Date: 2025-10-18 18:29:34
2,3,5,6-tetraiodobenzene-1,4-dicarbonyl chloride structure
|
Common Name | 2,3,5,6-tetraiodobenzene-1,4-dicarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 28719-77-9 | Molecular Weight | 706.60800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8Cl2I4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5,6-tetraiodobenzene-1,4-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8Cl2I4O2 |
|---|---|
| Molecular Weight | 706.60800 |
| Exact Mass | 705.54500 |
| PSA | 34.14000 |
| LogP | 4.86300 |
| InChIKey | QECVPDRHDKMLRM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1c(I)c(I)c(C(=O)Cl)c(I)c1I |
|
~%
2,3,5,6-tetraio... CAS#:28719-77-9 |
| Literature: Qu, Weiqiang; Xia, Weijuan; Feng, Chao; Tuo, Xinlin; Qiu, Teng Journal of Polymer Science, Part A: Polymer Chemistry, 2011 , vol. 49, # 10 p. 2191 - 2198 |
|
~%
2,3,5,6-tetraio... CAS#:28719-77-9 |
| Literature: Qu, Weiqiang; Xia, Weijuan; Feng, Chao; Tuo, Xinlin; Qiu, Teng Journal of Polymer Science, Part A: Polymer Chemistry, 2011 , vol. 49, # 10 p. 2191 - 2198 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Benzenedicarbonyl dichloride,2,3,5,6-tetraiodo |
| 2,3,5,6-tetraiodoterephthalic acid dichloride |
| tetraiodoterephthalic acid dichloride |
| 2,3,5,6-tetraiodobenzene-1,4-dioyl dichloride |
| Tetrajod-terephthaloylchlorid |
| tetra-iodoterephthaloyl dichloride |
| tetraiodo-terephthaloyl chloride |
| Tetrajodterephthalsaeure-dichlorid |