2-(2-methyl-5-nitrophenyl)acetic acid structure
|
Common Name | 2-(2-methyl-5-nitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 287119-83-9 | Molecular Weight | 195.17200 | |
| Density | 1.346g/cm3 | Boiling Point | 400.385ºC at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.807ºC | |
| Name | 2-(2-methyl-5-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 400.385ºC at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 178.807ºC |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.05350 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | JCSRJKWRJVUXSQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1CC(=O)O |
| HS Code | 2916399090 |
|---|
|
~41%
2-(2-methyl-5-n... CAS#:287119-83-9 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; FINK, Brian; CHEN, Libing; GAVAI, Ashvinikumar; HE, Liqi; KIM, Soong-Hoon; NATION, Andrew; ZHAO, Yufen; ZHANG, Litai Patent: WO2010/42699 A1, 2010 ; Location in patent: Page/Page column 112-113 ; WO 2010/042699 A1 |
|
~%
2-(2-methyl-5-n... CAS#:287119-83-9 |
| Literature: IRM LLC Patent: WO2008/51757 A1, 2008 ; Location in patent: Page/Page column 33; 34 ; WO 2008/051757 A1 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methyl-5-nitrophenylacetic acid |
| Benzeneaceticacid, 2-methyl-5-nitro- |