methyl 2-(4-amino-3-nitrophenyl)acetate structure
|
Common Name | methyl 2-(4-amino-3-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 28694-94-2 | Molecular Weight | 210.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(4-amino-3-nitrophenyl)acetate |
|---|
| Molecular Formula | C9H10N2O4 |
|---|---|
| Molecular Weight | 210.18700 |
| Exact Mass | 210.06400 |
| PSA | 98.14000 |
| LogP | 1.99690 |
| InChIKey | KMSVFPDFFCHFRV-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc(N)c([N+](=O)[O-])c1 |
| HS Code | 2922499990 |
|---|
|
~87%
methyl 2-(4-ami... CAS#:28694-94-2 |
| Literature: ABBOTT LABORATORIES Patent: WO2004/76424 A1, 2004 ; Location in patent: Page 57 - 58 ; WO 2004/076424 A1 |
|
~18%
methyl 2-(4-ami... CAS#:28694-94-2 |
| Literature: TEMPERO PHARMACEUTICALS, INC.; BALOGLU, Erkan; BOHNERT, Gary, J.; GHOSH, Shomir; LOBERA, Mercedes; SCHMIDT, Darby, R.; SUNG, Leonard Patent: WO2013/19682 A1, 2013 ; Location in patent: Page/Page column 115 ; WO 2013/019682 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |