N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine
Modify Date: 2025-10-11 17:29:52
![N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine Structure](https://image.chemsrc.com/caspic/080/2864-61-1.png)
N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine structure
|
Common Name | N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 2864-61-1 | Molecular Weight | 332.54800 | |
| Density | 1.396g/cm3 | Boiling Point | 380.3ºC at 760mmHg | |
| Molecular Formula | C10H13Cl3NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.8ºC | |
| Name | N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760mmHg |
| Molecular Formula | C10H13Cl3NO3P |
| Molecular Weight | 332.54800 |
| Flash Point | 183.8ºC |
| Exact Mass | 330.97000 |
| PSA | 57.37000 |
| LogP | 5.17060 |
| Vapour Pressure | 5.52E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | PMWRWPFHACHCIJ-UHFFFAOYSA-N |
| SMILES | CCNP(=O)(OCC)Oc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ethyl 2,4,5-trichlorophenyl ethylphosphoramidate |
| Phosphoramidic acid,ethyl-,ethyl (2,4,5-trichlorophenyl) ester |
| Dowco 210 |