ethyl 3-[4-[[(4-ethoxyphenyl)methylene]amino]phenyl]acrylate structure
|
Common Name | ethyl 3-[4-[[(4-ethoxyphenyl)methylene]amino]phenyl]acrylate | ||
|---|---|---|---|---|
| CAS Number | 2863-94-7 | Molecular Weight | 323.38600 | |
| Density | 1.04g/cm3 | Boiling Point | 486.1ºC at 760mmHg | |
| Molecular Formula | C20H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.3ºC | |
| Name | ethyl 3-[4-[(4-ethoxyphenyl)methylideneamino]phenyl]prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760mmHg |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.38600 |
| Flash Point | 197.3ºC |
| Exact Mass | 323.15200 |
| PSA | 47.89000 |
| LogP | 4.41220 |
| Vapour Pressure | 1.34E-09mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | CVVDLYBLLWQIDB-BAAZBEGMSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(N=Cc2ccc(OCC)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl4-[2-(1,3-Dioxo-1,3-Dihydro-2h-Isoindol-2-Yl)Ethoxyl]-3-Oxobutanoate |
| ethyl 4-(2-phthalimido)ethoxyacetoacetate |
| ethyl 4-<4-ethoxybenzylideneamino>cinnamate |
| 2-(phthalimido)ethoxy>acetoacetate |
| p-ethoxy-benzylidene-p-amino-cinnamate d'ethyle |
| 4-<4-Aethoxy-benzylidenamino>-zimtsaeure-aethylester |
| Aethyl-<-cinnamat |
| 4-[2-(1,3-dioxo-1,3-dihydro-isoindol-2-yl)-ethoxy]-3-oxo-butyric acid ethyl ester |
| 4-(p-Aethoxy-benzylidenamino)-zimtsaeure-aethylester |
| 4-Ethoxy-benzylidenamino>-zimtsaeure-ethylester |
| 4-Aethoxybenzal-4-aminozimtsaeure-aethylester |
| Ethyl 4-(2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl) ethoxy)-3-oxobutanoate |
| ethyl 4-[2-(1,3-dioxoisoindolin-2-yl)ethoxy]-3-oxobutanoate |