L-Tyrosine,3-iodo-5-nitro- (9CI)
Modify Date: 2025-08-25 22:59:26
L-Tyrosine,3-iodo-5-nitro- (9CI) structure
|
Common Name | L-Tyrosine,3-iodo-5-nitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 28612-47-7 | Molecular Weight | 352.08300 | |
| Density | 2.073g/cm3 | Boiling Point | 429.7ºC at 760mmHg | |
| Molecular Formula | C9H9IN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 5-Jod-3-nitro-L-tyrosin |
|---|---|
| Synonym | More Synonyms |
| Density | 2.073g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760mmHg |
| Molecular Formula | C9H9IN2O5 |
| Molecular Weight | 352.08300 |
| Flash Point | 213.6ºC |
| Exact Mass | 351.95600 |
| PSA | 129.37000 |
| LogP | 2.08290 |
| Vapour Pressure | 3.8E-08mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | XSSBNPSCHWGIBA-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(I)c(O)c([N+](=O)[O-])c1)C(=O)O |
|
~%
L-Tyrosine,3-io... CAS#:28612-47-7 |
| Literature: Jurd Journal of the American Chemical Society, 1955 , vol. 77, p. 5747 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-iodo-5-nitro-L-tyrosine |
| 3-iodo-5-methyl-2-phenyl-thiophene |
| Thiophene,3-iodo-5-methyl-2-phenyl |
| 3-Jod-5-methyl-2-phenylthiophen |
| 3-Jod-5-nitro-L-tyrosin |