PMK ethyl glycidate structure
|
Common Name | PMK ethyl glycidate | ||
|---|---|---|---|---|
| CAS Number | 28578-16-7 | Molecular Weight | 250.247 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 327.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.0±27.9 °C | |
| Name | ethyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.8±42.0 °C at 760 mmHg |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.247 |
| Flash Point | 143.0±27.9 °C |
| Exact Mass | 250.084122 |
| PSA | 57.29000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | BRILFEZHPXQINW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C)OC1c1ccc2c(c1)OCO2 |
|
~%
PMK ethyl glycidate CAS#:28578-16-7 |
| Literature: Darzens Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1906 , vol. 142, p. 215 |
|
~%
PMK ethyl glycidate CAS#:28578-16-7 |
| Literature: Elks; Hey Journal of the Chemical Society, 1943 , p. 15 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethyl 3-(1,3-benzodioxol-5-yl)-2-methyl-2-oxiranecarboxylate |
| 2-Oxiranecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-2-methyl-, ethyl ester |
| PMK ethyl glycidate |