8-Allyl-7,8-dihydro-1,3-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione structure
|
Common Name | 8-Allyl-7,8-dihydro-1,3-dimethyl-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione | ||
|---|---|---|---|---|
| CAS Number | 28557-25-7 | Molecular Weight | 261.28000 | |
| Density | 1.45g/cm3 | Boiling Point | 452.4ºC at 760mmHg | |
| Molecular Formula | C12H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | 2,4-dimethyl-6-prop-2-enyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 452.4ºC at 760mmHg |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28000 |
| Flash Point | 227.4ºC |
| Exact Mass | 261.12300 |
| PSA | 65.06000 |
| Vapour Pressure | 2.25E-08mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | NAZQXTHWEFCOOX-UHFFFAOYSA-N |
| SMILES | C=CCN1CCn2c1nc1c2c(=O)n(C)c(=O)n1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dimethyl-8-(prop-2-en-1-yl)-7,8-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione |
| 1H-Imidazo(2,1-f)purine-2,4(3H,6H)-dione,7,8-dihydro-1,3-dimethyl-8-(2-propenyl) |
| 8-allyl-1,3-dimethyl-7,8-dihydro-1H,6H-imidazo[2,1-f]purine-2,4-dione |
| KT 136 |
| 7,8-Dihydro-1,3-dimethyl-8-(2-propenyl)-1H-imidazo(2,1-f)purine-2,4(3H,6H)-dione |