2-chloro-N-(2-diethylaminoethyl)benzamide structure
|
Common Name | 2-chloro-N-(2-diethylaminoethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2852-24-6 | Molecular Weight | 254.75600 | |
| Density | 1.1g/cm3 | Boiling Point | 379.3ºC at 760mmHg | |
| Molecular Formula | C13H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | 2-chloro-N-[2-(diethylamino)ethyl]benzamide |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760mmHg |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.75600 |
| Flash Point | 183.2ºC |
| Exact Mass | 254.11900 |
| PSA | 32.34000 |
| LogP | 2.80250 |
| Vapour Pressure | 5.91E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | GYHFCFBYGSFHJF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-N-(2-d... CAS#:2852-24-6 |
| Literature: Melandri,M. et al. Bollettino Chimico Farmaceutico, 1964 , vol. 103, p. 895 - 903 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |