3(2H)-Pyridazinone,4-(4-methoxyphenyl)-5,6-diphenyl-
Modify Date: 2025-09-05 13:24:58
3(2H)-Pyridazinone,4-(4-methoxyphenyl)-5,6-diphenyl- structure
|
Common Name | 3(2H)-Pyridazinone,4-(4-methoxyphenyl)-5,6-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 28506-40-3 | Molecular Weight | 354.40100 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-methoxyphenyl)-3,4-diphenyl-1H-pyridazin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.40100 |
| Exact Mass | 354.13700 |
| PSA | 54.98000 |
| LogP | 4.77950 |
| Index of Refraction | 1.625 |
| InChIKey | OAYYIKFKPKRFHB-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)n[nH]c2=O)cc1 |
|
~31%
3(2H)-Pyridazin... CAS#:28506-40-3 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-(4-methoxyphenyl)-5,6-diphenylpyridazin-3-ol |
| 4-p-Anisyl-5,6-diphenyl-3(2H)-pyridazon |
| 4-(4-methoxy-phenyl)-5,6-diphenyl-2H-pyridazin-3-one |