Benzenesulfonamide,4-chloro-N-[[(4-methyl-3-penten-1-yl)amino]carbonyl]- structure
|
Common Name | Benzenesulfonamide,4-chloro-N-[[(4-methyl-3-penten-1-yl)amino]carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 28490-27-9 | Molecular Weight | 316.80400 | |
| Density | 1.265g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H17ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)sulfonyl-3-(4-methylpent-3-enyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.80400 |
| Exact Mass | 316.06500 |
| PSA | 83.65000 |
| LogP | 4.54680 |
| Index of Refraction | 1.551 |
| InChIKey | GGMBGHKZVOQUES-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
|
~%
Benzenesulfonam... CAS#:28490-27-9 |
| Literature: Pala,G. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, # 3 p. 556 - 557 |
|
~%
Benzenesulfonam... CAS#:28490-27-9 |
| Literature: Pala,G. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, # 3 p. 556 - 557 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[(p-chlorophenyl)sulfonyl]-3-(4-methyl-3-pentenyl)-urea |
| 4-chloro-N-[(4-methylpent-3-en-1-yl)carbamoyl]benzenesulfonamide |