N,N-Diisopropylcarbamic acid 3-tert-butylphenyl ester structure
|
Common Name | N,N-Diisopropylcarbamic acid 3-tert-butylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 28460-10-8 | Molecular Weight | 277.40200 | |
| Density | 0.975g/cm3 | Boiling Point | 348.6ºC at 760mmHg | |
| Molecular Formula | C17H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.6ºC | |
| Name | (3-tert-butylphenyl) N,N-di(propan-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 348.6ºC at 760mmHg |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.40200 |
| Flash Point | 164.6ºC |
| Exact Mass | 277.20400 |
| PSA | 29.54000 |
| LogP | 4.60170 |
| Vapour Pressure | 4.98E-05mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | QOBLBOCEULVJIG-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)Oc1cccc(C(C)(C)C)c1)C(C)C |
| HS Code | 2924299090 |
|---|
|
~%
N,N-Diisopropyl... CAS#:28460-10-8 |
| Literature: Rips,R. et al. Chimica Therapeutica, 1970 , vol. 5, p. 418 - 421 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| R 982 |
| N,N-Diisopropylcarbamic acid 3-tert-butylphenyl ester |
| Phenol,3-tert-butyl-,diisopropylcarbamate |
| CARBAMIC ACID,N,N-DIISOPROPYL-,3-tert-BUTYLPHENYL ESTER |