2l5,4l5,6l5-1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4-tetrachloro-6,6-diphenyl-
Modify Date: 2025-09-28 20:39:50
2l5,4l5,6l5-1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4-tetrachloro-6,6-diphenyl- structure
|
Common Name | 2l5,4l5,6l5-1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4-tetrachloro-6,6-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 2846-32-4 | Molecular Weight | 430.96100 | |
| Density | 1.7g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl4N3P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4-Tetrachloro-6,6-diphenylcyclotriphosphazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Molecular Formula | C12H10Cl4N3P3 |
| Molecular Weight | 430.96100 |
| Exact Mass | 428.88400 |
| PSA | 66.51000 |
| LogP | 5.92160 |
| Index of Refraction | 1.705 |
| InChIKey | ULSUQJYUYDRTBX-UHFFFAOYSA-N |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP(c2ccccc2)(c2ccccc2)=N1 |
|
~%
2l5,4l5,6l5-1,3... CAS#:2846-32-4 |
| Literature: Elias, Anil J.; Muralidharan; Senthil Kumar; Venugopalan Journal of Fluorine Chemistry, 2006 , vol. 127, # 8 p. 1046 - 1053 |
|
~%
2l5,4l5,6l5-1,3... CAS#:2846-32-4 |
| Literature: Bode; Bach Chemische Berichte, 1942 , vol. 75, p. 225 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1707-03-5| 1,1-diphenyl-3,3,5,5-tetrachlorocyclotriphosphazene |
| 2,2-diphenyl-4,4,6,6-tetrachlorocyclotriphosphazatriene |
| 1,1-diphenyl-3,3,5,5-tetrachlorocyclotriphosphazatriene |
| 2,2,4,4-tetrachloro-6,6-diphenylcyclotriphosphazatriene |
| 2,2,4,4-tetrachloro-6,6-diphenylcyclotriphospazatriene |