9,10-Anthracenedione,1,2,3,4-tetrachloro-
Modify Date: 2025-10-12 18:46:51
9,10-Anthracenedione,1,2,3,4-tetrachloro- structure
|
Common Name | 9,10-Anthracenedione,1,2,3,4-tetrachloro- | ||
|---|---|---|---|---|
| CAS Number | 2841-29-4 | Molecular Weight | 345.99200 | |
| Density | 1.672g/cm3 | Boiling Point | 510.7ºC at 760mmHg | |
| Molecular Formula | C14H4Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 1,2,3,4-Tetrachloroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760mmHg |
| Molecular Formula | C14H4Cl4O2 |
| Molecular Weight | 345.99200 |
| Flash Point | 213.5ºC |
| Exact Mass | 343.89700 |
| PSA | 34.14000 |
| LogP | 5.07560 |
| Vapour Pressure | 1.52E-10mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | FEXPLBGUHRVUIU-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| HS Code | 2914700090 |
|---|
|
~%
9,10-Anthracene... CAS#:2841-29-4 |
| Literature: Kniel,P. Helvetica Chimica Acta, 1965 , vol. 48, p. 837 - 839 |
|
~%
9,10-Anthracene... CAS#:2841-29-4 |
| Literature: Kniel,P. Helvetica Chimica Acta, 1965 , vol. 48, p. 837 - 839 |
|
~%
9,10-Anthracene... CAS#:2841-29-4 |
| Literature: Roedig,A.; Foersch,M. Justus Liebigs Annalen der Chemie, 1978 , p. 1406 - 1415 |
CAS#:72-48-0
CAS#:81-42-5
CAS#:632-58-6
CAS#:84-45-7
CAS#:80034-21-5
CAS#:88-99-3| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,2,3,4-Tetrachloranthracen |
| 1,2,3,4-Tetrachlor-anthrachinon |
| 1,2,3,4-tetrachloro-anthracene |
| 1,2,3,4-Tetrachlor-anthracen-9,10-dion |
| 1,2,3,4-Tetrachlor-anthrachinon-(9,10) |
| Anthracene,1,2,3,4-tetrachloro |
| 1,2,3,4-tetrachloro-9,10-anthraquinone |