5-hexyl-1H-pyrimidine-2,4-dione structure
|
Common Name | 5-hexyl-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 28362-55-2 | Molecular Weight | 196.24600 | |
| Density | 1.052g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-hexyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.24600 |
| Exact Mass | 196.12100 |
| PSA | 66.24000 |
| LogP | 2.01060 |
| Index of Refraction | 1.479 |
| InChIKey | UIYZXYZMGAKDDW-UHFFFAOYSA-N |
| SMILES | CCCCCCc1c[nH]c(=O)[nH]c1=O |
|
~%
5-hexyl-1H-pyri... CAS#:28362-55-2 |
| Literature: Burckhalter; Scarborough Journal of the American Pharmaceutical Association (1912-1977), 1955 , vol. 44, p. 545,547 |
|
~%
5-hexyl-1H-pyri... CAS#:28362-55-2 |
| Literature: Burckhalter; Scarborough Journal of the American Pharmaceutical Association (1912-1977), 1955 , vol. 44, p. 545,547 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Hexyl-2,4(1H,3H)-pyrimidinedione |
| 5-Hexyl-1H-pyrimidin-2,4-dion |
| 5-Hexyl-uracil |
| 1-hexyluracil |
| Uracil,5-hexyl |