1,4-Bis(dihydroxyboryl)-2-nitrobenzene
Modify Date: 2025-09-13 11:23:48
1,4-Bis(dihydroxyboryl)-2-nitrobenzene structure
|
Common Name | 1,4-Bis(dihydroxyboryl)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 28362-31-4 | Molecular Weight | 210.74500 | |
| Density | 1.55g/cm3 | Boiling Point | 507.5ºC at 760mmHg | |
| Molecular Formula | C6H7B2NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.7ºC | |
| Name | (4-borono-2-nitrophenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 507.5ºC at 760mmHg |
| Molecular Formula | C6H7B2NO6 |
| Molecular Weight | 210.74500 |
| Flash Point | 260.7ºC |
| Exact Mass | 211.04600 |
| PSA | 126.74000 |
| Vapour Pressure | 4.04E-11mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | GGASDGRERPDUQP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(B(O)O)ccc1B(O)O |
| HS Code | 2916399090 |
|---|
|
~%
1,4-Bis(dihydro... CAS#:28362-31-4 |
| Literature: Faury, Thomas; Dumur, Frederic; Clair, Sylvain; Abel, Mathieu; Porte, Louis; Gigmes, Didier CrystEngComm, 2013 , vol. 15, # 11 p. 2067 - 2075 |
|
~%
1,4-Bis(dihydro... CAS#:28362-31-4 |
| Literature: Faury, Thomas; Dumur, Frederic; Clair, Sylvain; Abel, Mathieu; Porte, Louis; Gigmes, Didier CrystEngComm, 2013 , vol. 15, # 11 p. 2067 - 2075 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-nitro-1,4-benzenediboronic acid |
| 2-Nitrobenzene-1,4-diboronic acid |
| (2-nitro-p-phenylene)-bis-boronic acid |
| 2-Nitrobenzol-1,4-diborsaeure |
| p-Benzenediboronic acid,2-nitro |