4-Chloro-2-[3-(o-methoxyphenyl)propenoyl]phenoxyacetic acid structure
|
Common Name | 4-Chloro-2-[3-(o-methoxyphenyl)propenoyl]phenoxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 28328-73-6 | Molecular Weight | 346.76200 | |
| Density | 1.329g/cm3 | Boiling Point | 562.1ºC at 760mmHg | |
| Molecular Formula | C18H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | 2-[4-chloro-2-[3-(2-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 562.1ºC at 760mmHg |
| Molecular Formula | C18H15ClO5 |
| Molecular Weight | 346.76200 |
| Flash Point | 293.7ºC |
| Exact Mass | 346.06100 |
| PSA | 72.83000 |
| LogP | 3.70810 |
| Vapour Pressure | 1.8E-13mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | NFDFMINPBPDHEE-SOFGYWHQSA-N |
| SMILES | COc1ccccc1C=CC(=O)c1cc(Cl)ccc1OCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetic acid,2-[4-chloro-2-[3-(2-methoxyphenyl)-1-oxo-2-propen-1-yl]phenoxy] |
| 2-(4-CHLORO-2-(3-(2-METHOXYPHENYL)ACRYLOYL)PHENOXY)ACETIC ACID |
| Aceticacid,[4-chloro-2-(o-methoxycinnamoyl)phenoxy]-(8CI) |
| 2-(2-Methoxycinnamoyl)-4-chlorophenoxyaceticacid |