2-Propen-1-one,3-(1,3-benzodioxol-5-yl)-1-(5-chloro-2-hydroxyphenyl)- structure
|
Common Name | 2-Propen-1-one,3-(1,3-benzodioxol-5-yl)-1-(5-chloro-2-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 28328-71-4 | Molecular Weight | 302.70900 | |
| Density | 1.432g/cm3 | Boiling Point | 498ºC at 760mmHg | |
| Molecular Formula | C16H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(5-chloro-2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 498ºC at 760mmHg |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.70900 |
| Flash Point | 255ºC |
| Exact Mass | 302.03500 |
| PSA | 55.76000 |
| LogP | 3.67040 |
| Vapour Pressure | 1.54E-10mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | YPGXNIHFYIFXQL-DAFODLJHSA-N |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)c1cc(Cl)ccc1O |
|
~77%
2-Propen-1-one,... CAS#:28328-71-4 |
| Literature: LG Chemical, Ltd. Patent: US6500846 B1, 2002 ; |
|
~92%
2-Propen-1-one,... CAS#:28328-71-4 |
| Literature: Wang, Fang-Wu; Wang, Sheng-Qing; Zhao, Bao-Xiang; Miao, Jun-Ying Organic and Biomolecular Chemistry, 2014 , vol. 12, # 19 p. 3062 - 3070 |
|
~70%
2-Propen-1-one,... CAS#:28328-71-4 |
| Literature: LG Chemical, Ltd. Patent: US6500846 B1, 2002 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5'-Chlor-2'-hydroxy-3,4-methylendioxychalkon |