inositol 3-phosphate structure
|
Common Name | inositol 3-phosphate | ||
|---|---|---|---|---|
| CAS Number | 2831-74-5 | Molecular Weight | 336.29800 | |
| Density | 2.02g/cm3 | Boiling Point | 517.4ºC at 760 mmHg | |
| Molecular Formula | C18H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7ºC | |
| Name | 1D-myo-inositol 3-phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 517.4ºC at 760 mmHg |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.29800 |
| Flash Point | 266.7ºC |
| Exact Mass | 336.07500 |
| PSA | 83.99000 |
| LogP | 1.80630 |
| Vapour Pressure | 7.17E-13mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | INAPMGSXUVUWAF-LXOASSSBSA-N |
| SMILES | O=P(O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| HS Code | 2919900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione,5,5'-oxybis(2-methyl |
| inositol-2-monophosphate |
| 2-methyl-5-(2-methyl-1,3-dioxoisoindol-5-yl)oxyisoindole-1,3-dione |
| myo-inositol 2-phosphate,free acid |
| DL-myo-inositol 2-mono(phosphate) |
| myo-inositol 2-monophosphate |
| D-myo-inositol 2-monophosphate |
| myo-Inositol 2-phosphate |