2,5-Cyclohexadiene-1,4-dione,2,5-diazido-3,6-diphenyl-
Modify Date: 2025-10-11 16:54:34
2,5-Cyclohexadiene-1,4-dione,2,5-diazido-3,6-diphenyl- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-diazido-3,6-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 28293-31-4 | Molecular Weight | 342.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H10N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-diazido-3,6-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H10N6O2 |
|---|---|
| Molecular Weight | 342.31100 |
| Exact Mass | 342.08700 |
| PSA | 133.64000 |
| LogP | 3.48692 |
| InChIKey | BDFPTOSJXBFWAL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1=C(c2ccccc2)C(=O)C(N=[N+]=[N-])=C(c2ccccc2)C1=O |
|
~%
2,5-Cyclohexadi... CAS#:28293-31-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
|
~%
2,5-Cyclohexadi... CAS#:28293-31-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:28293-26-7
CAS#:4553-07-5| 2,5-Diazido-3,6-diphenyl-p-benzoquinone |
| 2,5-Diazido-3,6-diphenylbenzochinon |
| 2,5-Diazido-3,6-diphenyl-1,4-benzochinon |
| 3,6-diphenyl-2,5-diazido-1,4-benzoquinone |