2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-bis(4-methylphenyl)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dihydroxy-3,6-bis(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 28293-15-4 | Molecular Weight | 320.33900 | |
| Density | 1.375g/cm3 | Boiling Point | 551ºC at 760 mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.1ºC | |
| Name | 2,5-dihydroxy-3,6-bis(4-methylphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 551ºC at 760 mmHg |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 301.1ºC |
| Exact Mass | 320.10500 |
| PSA | 74.60000 |
| LogP | 3.69360 |
| Vapour Pressure | 5.63E-13mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | QUOHQFDAFULRSX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=C(O)C(=O)C(c3ccc(C)cc3)=C(O)C2=O)cc1 |
|
~%
2,5-Cyclohexadi... CAS#:28293-15-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
|
~%
2,5-Cyclohexadi... CAS#:28293-15-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
|
~%
2,5-Cyclohexadi... CAS#:28293-15-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |