4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester structure
|
Common Name | 4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 28269-03-6 | Molecular Weight | 200.189 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 299.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.6±27.4 °C | |
| Name | 4-oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 299.0±40.0 °C at 760 mmHg |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.189 |
| Flash Point | 130.6±27.4 °C |
| Exact Mass | 200.068466 |
| PSA | 69.67000 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | GMKJWKXCHOWVDN-RNFRBKRXSA-N |
| SMILES | COC(=O)C1CC(=O)CC1C(=O)OC |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| trans-1,2-diphenyl-cyclopropane |
| Dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| 4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester |
| trans dimethyl cyclopentanone 3,4-dicarboxylate |
| rac-trans-1,2-diphenylcyclopropane |
| diphenylcyclopropane |
| Dimethyl (1R,2R)-4-oxo-1,2-cyclopentanedicarboxylate |
| (1R,2R)-4-Oxo-cyclopentane-1,2-dicarboxylic acid dimethyl ester |
| 1,2-Cyclopentanedicarboxylic acid, 4-oxo-, dimethyl ester, (1R,2R)- |