Phosphonium,(cyanophenylmethyl)triphenyl-, bromide (1:1)
Modify Date: 2025-09-10 12:35:47
Phosphonium,(cyanophenylmethyl)triphenyl-, bromide (1:1) structure
|
Common Name | Phosphonium,(cyanophenylmethyl)triphenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 28255-59-6 | Molecular Weight | 458.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21BrNP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [cyano(phenyl)methyl]-triphenylphosphanium |
|---|
| Molecular Formula | C26H21BrNP |
|---|---|
| Molecular Weight | 458.32900 |
| Exact Mass | 457.05900 |
| PSA | 37.38000 |
| LogP | 2.24938 |
| InChIKey | LMTIYGJMQYYEOA-UHFFFAOYSA-N |
| SMILES | N#CC(c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
Phosphonium,(cy... CAS#:28255-59-6 |
| Literature: Devlin,C.J.; Walker,B.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1428 - 1431 |
|
~%
Phosphonium,(cy... CAS#:28255-59-6 |
| Literature: Devlin,C.J.; Walker,B.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1428 - 1431 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |